« Liriodendrine » : différence entre les versions
Apparence
Contenu supprimé Contenu ajouté
Nouvelle page : {{ébauche|botanique|chimie}} La '''liriodendrine''', substance retirée de l'écorce du liriodendron (ou tulipier) est un alcaloïde succédané de la quinine. == Bi... |
+ chimiebox+ wikif |
||
Ligne 1 : | Ligne 1 : | ||
{{ébauche|botanique|chimie}} |
{{ébauche|botanique|chimie}} |
||
{{Infobox Chimie |
|||
La '''liriodendrine''', substance retirée de l'écorce du [[liriodendron]] (ou tulipier) est un [[alcaloïde]] succédané de la [[quinine]]. |
|||
| nom = Liriodendrine |
|||
| image = Liriodendrin.svg |
|||
| image2 = |
|||
| tailleimage = 300px |
|||
| legende = |
|||
<!-- Général --> |
|||
| DCI = |
|||
| nomIUPAC = (2S,3R,4S,5S,6R)-2-[4-[6-[3,5-diméthoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxyméthyl)oxan-2-yl]oxyphényl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-diméthoxyphenoxy]-6-(hydroxyméthyl)oxane-3,4,5-triol |
|||
| nomSystematique = |
|||
| synonymes = (tétrahydro-1H,3H-furo(3,4-c)furan-1,4-diyl)bis(2,6-diméthoxy-4,1-phénylène)bis-bêta-D-glucopyranoside |
|||
| CAS = {{CAS|573-44-4}}<ref name=S>{{Sigma-Aldrich|Sigma|SMB00181|Nom=Liriodendrin ≥85% (LC/MS-ELSD)|Date=19 juin 2017}} + (pdf) [http://www.sigmaaldrich.com/MSDS/MSDS/DisplayMSDSPage.do?country=Fr&language=en&brand=SIGMA&productNumber=SMB00181 Fiche MSDS]</ref><br>{{CAS|96038-87-8}} |
|||
| EINECS = {{EINECS|}} |
|||
| RTECS = {{RTECS|}} |
|||
| ATC = {{ATC|}} {{ATCvet|}} |
|||
| DrugBank = |
|||
| PubChem = {{CID|73636}}{{SID|}} |
|||
| chEBI = |
|||
| NrE = {{NrE|}} |
|||
| FEMA = {{FEMA|}} |
|||
| SMILES = COC1=CC(=CC(=C1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC)C3C4COC(C4CO3)C5=CC(=C(C(=C5)OC)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)OC |
|||
| InChI = 1S/C34H46O18/c1-43-17-5-13(6-18(44-2)31(17)51-33-27(41)25(39)23(37)21(9-35)49-33)29-15-11-48-30(16(15)12-47-29)14-7-19(45-3)32(20(8-14)46-4)52-34-28(42)26(40)24(38)22(10-36)50-34/h5-8,15-16,21-30,33-42H,9-12H2,1-4H3/t15-,16-,21+,22+,23+,24+,25-,26-,27+,28+,29+,30+,33-,34-/m0/s1 |
|||
| InChIKey = FFDULTAFAQRACT-XKBSQSBASA-N |
|||
| StdInChI = |
|||
| StdInChIKey = |
|||
| apparence = |
|||
<!-- Propriétés chimiques --> |
|||
| formule = |C=34|H=46|O=18 |
|||
| masseMol = |
|||
| pKa = {{pKa||T(°C)=|T(K)=}} |
|||
| momentDipolaire = {{unité/2||D}} |
|||
| susceptibiliteMagnetique = |
|||
| diametreMoleculaire = {{unité/2||nm}} |
|||
| indiceIode = |
|||
| indiceAcide = |
|||
| indiceSaponification = |
|||
<!-- Propriétés physiques --> |
|||
| TTransitionVitreuse = {{tmp||°C}} |
|||
| fusion = {{tmp|269|°C}}<ref name=S/>{{,}}<ref name=P>PubChem CID {{CID|73636}}</ref> |
|||
| ebullition = {{tmp||°C}} |
|||
| solubilite = {{Unité/2||g||l|-1}} |
|||
| parametreSolubilite = <!-- {{Unité/2||MPa|1/2}} ({{température||°C}}) --> |
|||
| miscibilite = |
|||
| masseVolumique = {{Unité/2||g||cm|-3}} |
|||
| TAutoInflammation = {{tmp||°C}} |
|||
| pointEclair = {{tmp||°C|coupelle fermée}} |
|||
| limitesExplosivite = |
|||
| pressionVapeur = |
|||
| viscosite = |
|||
| pointCritique = |
|||
| pointTriple = |
|||
| conductivitéThermique = {{Unité/2||W||m|-1|K|-1}} |
|||
| conductivitéÉlectrique = |
|||
| vitesseSon = {{Unité/2||m||s|-1}} |
|||
<!-- Thermochimie --> |
|||
| emsGaz = {{Unité/2||J||K|-1|mol|-1}} |
|||
| emsLiquide = {{Unité/2||J||K|-1|mol|-1}} |
|||
| emsSolide = {{Unité/2||J||K|-1|mol|-1}} |
|||
| esfGaz = {{Unité/2||kJ||mol|-1}} |
|||
| esfLiquide = {{Unité/2||kJ||mol|-1}} |
|||
| esfSolide = {{Unité/2||kJ||mol|-1}} |
|||
| enthFus = |
|||
| enthVap = |
|||
| capaciteTherm = {{Unité/2||J||K|-1|mol|-1}} |
|||
| PCS = |
|||
| PCI = |
|||
<!-- Propriétés biochimiques --> |
|||
| codons = |
|||
| pHisoelectrique = |
|||
| acideAmineEss = |
|||
<!-- Propriétés électroniques --> |
|||
| bandeInterdite = |
|||
| mobilitEelectronique = |
|||
| mobiliteTrous = |
|||
| 1reEnergieIonisation = |
|||
| constanteDielectrique = |
|||
<!-- Cristallographie --> |
|||
| systemeCristallin = |
|||
| reseauBravais = |
|||
| Pearson = {{SymbolePearson|}} |
|||
| classe = <!-- '' ''{{surligner|}}'' '' (n<sup>o</sup> )--> {{Infobox Chimie/Groupe espace||ref=}} |
|||
| Schoenflies = |
|||
| Strukturbericht = |
|||
| structureType = |
|||
| parametresMaille = |
|||
| volume = |
|||
| densiteTheorique = |
|||
| macle = |
|||
<!-- Propriétés optiques --> |
|||
| refraction = <!--<math>\textit{n}_{D}^{20}</math> = -->{{réfraction|T=|?=|}} |
|||
| birefringence = |
|||
| dispersion = |
|||
| polychroisme = |
|||
| fluorescence = <!--<math>\lambda</math><sub>excitation</sub> {{?||nm}};<br /><math>\lambda</math><sub>émission</sub> {{?||nm}} --> |
|||
| absorption = |
|||
| transparence = |
|||
| pvrRotatoire = <!--<math>\lbrack\alpha\rbrack_{D}^{25}</math>--> |
|||
| cteVerdet = |
|||
<!-- Précautions --> |
|||
| 67548EECref = |
|||
| symboles = | |
|||
| numeroIndex = {{indexCE|}} |
|||
| classificationCE = |
|||
| r = | |
|||
| s = | |
|||
| transportRef = |
|||
| transport = {{ADR|Kemler=|ONU=|Classe=|CodeClassification=|Etiquette=|Etiquette2=|Etiquette3=|Emballage=}} |
|||
| NFPA704ref = |
|||
| NFPA704 = {{NFPA 704|Health=|Flammability=|Reactivity=|Other=}} |
|||
| SIMDUTref = |
|||
| SIMDUT = {{SIMDUT|}} |
|||
| SGHref = <ref name=P/> |
|||
| SGH = {{SGH|SGH07|H302|P264|P270|P301+P312|P330|P501}} |
|||
| CIRC = |
|||
| inhalation = |
|||
| peau = |
|||
| yeux = |
|||
| ingestion = |
|||
<!-- Écotoxicologie --> |
|||
| DL50 = <!-- (souris, [[Ingestion|oral]])<br />(souris, [[Injection intraveineuse|i.v.]])<br />(souris, [[sous-cutané|s.c.]])<br />(souris, [[intrapéritonéal|i.p.]])<br />(souris, [[Injection intramusculaire|i.m.]])--> |
|||
| CL50 = |
|||
| LogP = ([[octanol]]/eau) -0,951<ref name=S/> |
|||
| DJA = |
|||
| odorat = |
|||
<!-- Classe thérapeutique --> |
|||
| classeTherapeutique = |
|||
<!-- Données pharmacocinétiques --> |
|||
| CAM = |
|||
| biodisponibilite = |
|||
| liaisonProteique = |
|||
| metabolisme = |
|||
| demiVieDistrib = |
|||
| demiVieElim = |
|||
| stockage = |
|||
| excretion = |
|||
<!-- Considérations thérapeutiques --> |
|||
| voieAdministration = |
|||
| grossesse = |
|||
| conduiteAuto = |
|||
| precautions = |
|||
| antidote = |
|||
<!-- Caractère psychotrope --> |
|||
| categoriePsycho = |
|||
| modeConsommation = |
|||
| autresNoms = |
|||
| risqueDependance = |
|||
<!-- Composés apparentés --> |
|||
| autres = |
|||
| autrescations = |
|||
| autresanions = |
|||
| isomères = |
|||
<!-- Supplément --> |
|||
| supplement = |
|||
}}<!-- ----------------------------- Fin de l'infoboite ----------------------------- --> |
|||
La '''liriodendrine''', substance retirée de l'écorce du [[liriodendron]] (ou tulipier) est un [[alcaloïde]] succédané de la [[quinine]]. Elle est également un [[lignane]] anti-[[arythmie]] isolé de ''[[Pittosporum]]''<ref>C. Feng, B. G. Li, X. P. Gao, H. Y. Qi, G. L. Zhang, ''A new triterpene and an antiarrhythmic liriodendrin from Pittosporum brevicalyx', Archives of pharmacal research, 2010, vol. 33(12), pp. 1927-1932. {{PMID|21191756}}, {{DOI|10.1007/s12272-010-1206-1}}.</ref>. |
|||
== Notes et références == |
|||
<references /> |
|||
== Bibliographie == |
== Bibliographie == |
||
{{Autres projets|commons=Category:Alkaloids}} |
|||
* Arnold Brossi, ''The Alkaloïds, Chemistry and Pharmacology'', Academic Press, 1989. |
* Arnold Brossi, ''The Alkaloïds, Chemistry and Pharmacology'', Academic Press, 1989. |
||
* Jacques E. Poisson, article ''Alcaloïdes'', ''Encyclopædia Universalis'', 2011. |
* Jacques E. Poisson, article ''Alcaloïdes'', ''Encyclopædia Universalis'', 2011. |
||
== Liens externes == |
|||
{{Autres projets |
{{Autres projets |
||
|commons=Category:Liriodendron |
|commons=Category:Liriodendron |
||
Ligne 14 : | Ligne 169 : | ||
}} |
}} |
||
{{Portail|Biochimie|médecine|pharmacie|botanique}} |
{{Portail|Chimie|Biochimie|médecine|pharmacie|botanique}} |
||
[[Catégorie:Alcaloïde]] |
[[Catégorie:Alcaloïde]] |
Version du 19 juin 2017 à 07:50
Liriodendrine | |
Identification | |
---|---|
Nom UICPA | (2S,3R,4S,5S,6R)-2-[4-[6-[3,5-diméthoxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxyméthyl)oxan-2-yl]oxyphényl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-2,6-diméthoxyphenoxy]-6-(hydroxyméthyl)oxane-3,4,5-triol |
Synonymes |
(tétrahydro-1H,3H-furo(3,4-c)furan-1,4-diyl)bis(2,6-diméthoxy-4,1-phénylène)bis-bêta-D-glucopyranoside |
No CAS | [1] |
PubChem | 73636 |
SMILES | |
InChI | |
Propriétés chimiques | |
Formule | C34H46O18 [Isomères] |
Masse molaire[2] | 742,718 2 ± 0,035 8 g/mol C 54,98 %, H 6,24 %, O 38,78 %, |
Propriétés physiques | |
T° fusion | 269 °C[1],[3] |
Précautions | |
SGH[3] | |
H302, P264, P270, P330, P301+P312 et P501 |
|
Écotoxicologie | |
LogP | (octanol/eau) -0,951[1] |
Unités du SI et CNTP, sauf indication contraire. | |
modifier |
La liriodendrine, substance retirée de l'écorce du liriodendron (ou tulipier) est un alcaloïde succédané de la quinine. Elle est également un lignane anti-arythmie isolé de Pittosporum[4].
Notes et références
- Fiche Sigma-Aldrich du composé Liriodendrin ≥85% (LC/MS-ELSD), consultée le 19 juin 2017. + (pdf) Fiche MSDS
- Masse molaire calculée d’après « Atomic weights of the elements 2007 », sur www.chem.qmul.ac.uk.
- PubChem CID 73636
- C. Feng, B. G. Li, X. P. Gao, H. Y. Qi, G. L. Zhang, A new triterpene and an antiarrhythmic liriodendrin from Pittosporum brevicalyx', Archives of pharmacal research, 2010, vol. 33(12), pp. 1927-1932. DOI 10.1007/s12272-010-1206-1. ,
Bibliographie
- Arnold Brossi, The Alkaloïds, Chemistry and Pharmacology, Academic Press, 1989.
- Jacques E. Poisson, article Alcaloïdes, Encyclopædia Universalis, 2011.